![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Advanced Drawings.uxf | 2022-04-26 12:52 | 15K | |
| Custom Drawings.uxf | 2022-04-26 12:52 | 11K | |
| Deprecated UML Sequence - All in one.uxf | 2022-04-26 12:52 | 666 | |
| Generic Colors.uxf | 2022-04-26 12:52 | 3.8K | |
| Generic Layers.uxf | 2022-04-26 12:52 | 1.7K | |
| Generic Text and Alignment.uxf | 2022-04-26 12:52 | 4.1K | |
| Plots.uxf | 2022-04-26 12:52 | 4.4K | |
| UML Activity - All in one.uxf | 2022-04-26 12:52 | 1.0K | |
| UML Activity.uxf | 2022-04-26 12:52 | 9.9K | |
| UML Class.uxf | 2022-04-26 12:52 | 7.8K | |
| UML Common Elements.uxf | 2022-04-26 12:52 | 9.2K | |
| UML Composite Structure.uxf | 2022-04-26 12:52 | 3.8K | |
| UML Package.uxf | 2022-04-26 12:52 | 3.3K | |
| UML Sequence - All in one.uxf | 2022-04-26 12:52 | 2.8K | |
| UML Sequence.uxf | 2022-04-26 12:52 | 7.2K | |
| UML State Machine.uxf | 2022-04-26 12:52 | 3.4K | |
| UML Structure and Deployment.uxf | 2022-04-26 12:52 | 2.7K | |
| UML Timing Diagram.uxf | 2022-04-26 12:52 | 2.0K | |
| UML Use Case.uxf | 2022-04-26 12:52 | 4.2K | |