![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 4A Flyer/ | 2014-07-21 17:01 | - | |
| Ambulance/ | 2014-07-21 17:01 | - | |
| Anteater/ | 2014-07-21 17:01 | - | |
| Centipede/ | 2014-07-21 17:01 | - | |
| Chicken Coop/ | 2014-07-21 17:01 | - | |
| Computer War/ | 2014-07-21 17:01 | - | |
| CorComp Home Sentury/ | 2014-07-21 17:01 | - | |
| CorComp Peripheral Diagnostic Module/ | 2014-07-21 17:01 | - | |
| CorComp TI to IBM/ | 2014-07-21 17:01 | - | |
| Data Base Manager/ | 2014-07-21 17:01 | - | |
| Decimal Deli 2/ | 2014-07-21 17:01 | - | |
| Defender/ | 2014-07-21 17:01 | - | |
| Diagnostic (French)/ | 2014-07-21 17:01 | - | |
| Dig Dug/ | 2014-07-21 17:01 | - | |
| Disk Fixer/ | 2014-07-21 17:01 | - | |
| Disk Manager 3/ | 2014-07-21 17:01 | - | |
| Donkey Kong/ | 2014-07-21 17:01 | - | |
| Driving Demon/ | 2014-07-21 17:01 | - | |
| EA-TI Writer-Disk Manager combo/ | 2014-07-21 17:01 | - | |
| ET at Sea/ | 2014-07-21 17:01 | - | |
| ET on Land/ | 2014-07-21 17:01 | - | |
| Edupack/ | 2014-07-21 17:01 | - | |
| Escape/ | 2014-07-21 17:01 | - | |
| Extended Basic v2.5/ | 2014-07-21 17:01 | - | |
| Fantastic Fractions/ | 2014-07-21 17:01 | - | |
| Fantasy/ | 2014-07-21 17:01 | - | |
| Frogger/ | 2014-07-21 17:01 | - | |
| GPL/ | 2014-07-21 17:01 | - | |
| Germ Partol/ | 2014-07-21 17:01 | - | |
| German Demonstratio/ | 2014-07-21 17:01 | - | |
| German Statistics/ | 2014-07-21 17:01 | - | |
| Gestion Privee/ | 2014-07-21 17:01 | - | |
| Gravity/ | 2014-07-21 17:01 | - | |
| Henpecked/ | 2014-07-21 17:01 | - | |
| Homework Helper/ | 2014-07-21 17:01 | - | |
| Jungle Hunt/ | 2014-07-21 17:01 | - | |
| Key to Spanish/ | 2014-07-21 17:01 | - | |
| King of the Castle/ | 2014-07-21 17:01 | - | |
| Link/ | 2014-07-21 17:01 | - | |
| MS Pacman/ | 2014-07-21 17:01 | - | |
| Mighty Multiplication/ | 2014-07-21 17:01 | - | |
| Milliken Manager/ | 2014-07-21 17:01 | - | |
| Milliken combination module/ | 2014-07-21 17:01 | - | |
| Milton Bradley Cardsharp/ | 2014-07-21 17:01 | - | |
| Milton Bradley Gamevision Demo/ | 2014-07-21 17:01 | - | |
| Moon Patrol/ | 2014-07-21 17:01 | - | |
| Mouse Attack/ | 2014-07-21 17:01 | - | |
| Munchman 2/ | 2014-07-21 17:01 | - | |
| Music Maker SDA/ | 2014-07-21 17:01 | - | |
| P-code/ | 2014-07-21 17:01 | - | |
| Pacman/ | 2014-07-21 17:01 | - | |
| Paint N' Print/ | 2014-07-21 17:01 | - | |
| Peter Pan/ | 2014-07-21 17:01 | - | |
| Picture Parts/ | 2014-07-21 17:01 | - | |
| Pinocchio's Great Escape/ | 2014-07-21 17:01 | - | |
| Plant Genetics/ | 2014-07-21 17:01 | - | |
| Pole Position/ | 2014-07-21 17:01 | - | |
| Popeye/ | 2014-07-21 17:01 | - | |
| Princess and the Frog/ | 2014-07-21 17:01 | - | |
| Protector/ | 2014-07-21 17:01 | - | |
| Pyramid Puzzler/ | 2014-07-21 17:01 | - | |
| Qbert/ | 2014-07-21 17:01 | - | |
| RXB v1005/ | 2014-07-21 17:02 | - | |
| Reading Adventure/ | 2014-07-21 17:01 | - | |
| Reading Cheer/ | 2014-07-21 17:01 | - | |
| Reading Power/ | 2014-07-21 17:01 | - | |
| Reading Trail/ | 2014-07-21 17:01 | - | |
| Reading Wonders/ | 2014-07-21 17:02 | - | |
| Romox Demo/ | 2014-07-21 17:02 | - | |
| Roto Raiders/ | 2014-07-21 17:02 | - | |
| SF School Management Applications/ | 2014-07-21 17:02 | - | |
| Schnozola/ | 2014-07-21 17:02 | - | |
| Shamus/ | 2014-07-21 17:02 | - | |
| Simon/ | 2014-07-21 17:02 | - | |
| Space Journey/ | 2014-07-21 17:02 | - | |
| Speed Reading/ | 2014-07-21 17:02 | - | |
| Star Maze/ | 2014-07-21 17:02 | - | |
| Starship Pegasus/ | 2014-07-21 17:02 | - | |
| Strike Three/ | 2014-07-21 17:02 | - | |
| Super Disk Manager/ | 2014-07-21 17:02 | - | |
| Super Duper/ | 2014-07-21 17:02 | - | |
| TI Calc/ | 2014-07-21 17:02 | - | |
| TI Logo II (German)/ | 2014-07-21 17:02 | - | |
| TI Logo II (Italian)/ | 2014-07-21 17:02 | - | |
| Topper/ | 2014-07-21 17:02 | - | |
| Triton Super Extended Basic/ | 2014-07-21 17:02 | - | |
| Tunnels of Doom/ | 2014-07-21 17:02 | - | |
| Typo II/ | 2014-07-21 17:02 | - | |
| Typoman/ | 2014-07-21 17:02 | - | |
| Vat Accounting (Buchungsjournal)/ | 2014-07-21 17:02 | - | |
| Verb Viper/ | 2014-07-21 17:02 | - | |
| Video Chess (German)/ | 2014-07-21 17:02 | - | |
| Von Drake's Molecular Mission/ | 2014-07-21 17:02 | - | |
| Wing War/ | 2014-07-21 17:02 | - | |